CAS 1628555-75-8 is the registry number for Methyl DL-(3S,4R)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 100g.
Methyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylate (CAS 1628555-75-8) is a chemical compound with the molecular formula C19H20FNO2 and a molecular weight of 313.4 g/mol. IUPAC name: methyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylate. InChIKey: NFNACWDXDQTQCQ-ZWKOTPCHSA-N.
| Molecular formula | C19H20FNO2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | methyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylate |
| InChIKey | NFNACWDXDQTQCQ-ZWKOTPCHSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@H]1C2=CC=C(C=C2)F)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)