CAS 698358-91-7 is the registry number for Methyl trans-1-benzyl-4-(3-fluorophenyl)pyrrolidine-3-carboxylate,, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidine-3-carboxylate (CAS 698358-91-7) is a chemical compound with the molecular formula C19H20FNO2 and a molecular weight of 313.4 g/mol. IUPAC name: methyl (3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidine-3-carboxylate. InChIKey: GJPDRAYPGFFTGY-MSOLQXFVSA-N.
| Molecular formula | C19H20FNO2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | methyl (3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidine-3-carboxylate |
| InChIKey | GJPDRAYPGFFTGY-MSOLQXFVSA-N |
| SMILES | COC(=O)[C@H]1CN(C[C@@H]1C2=CC(=CC=C2)F)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)