CAS 1628572-51-9 appears in our catalog under these names: 4-Fluorobenzo[d][1,3]dioxole-2-thione, 98%, 4-Fluorobenzo[d][1,3]dioxole-2-thione, >97%, >97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-fluoro-1,3-benzodioxole-2-thione (CAS 1628572-51-9) is a chemical compound with the molecular formula C7H3FO2S and a molecular weight of 170.16 g/mol. IUPAC name: 4-fluoro-1,3-benzodioxole-2-thione. InChIKey: BNGSQDWQIBQYMM-UHFFFAOYSA-N.
| Molecular formula | C7H3FO2S |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 4-fluoro-1,3-benzodioxole-2-thione |
| InChIKey | BNGSQDWQIBQYMM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)OC(=S)O2 |
Computed by PubChem (NCBI)