Products 1628604-84-1
CAS 1628604-84-1 appears in our catalog under these names: (7R,8Ar)-7-methoxyoctahydropyrrolo[1,2-a]pyrazine, 95%, (7R,8AR)-7-methoxyoctahydropyrrolo(1,2-a)pyrazine, 97%, (7R,8aR)-7-Methoxy-octahydropyrrolo(1,2-a)piperazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 1000mg.
(7R,8aR)-7-methoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine (CAS 1628604-84-1) is a chemical compound with the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. IUPAC name: (7R,8aR)-7-methoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine. InChIKey: ATHHKQMHRWUULC-HTQZYQBOSA-N.
| Molecular formula | C8H16N2O |
|---|---|
| Molecular weight | 156.23 g/mol |
| IUPAC name | (7R,8aR)-7-methoxy-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
| InChIKey | ATHHKQMHRWUULC-HTQZYQBOSA-N |
| SMILES | CO[C@@H]1C[C@@H]2CNCCN2C1 |
Computed by PubChem (NCBI)