CAS 1628628-46-5 is the registry number for Ethyl (1S,3S,4R)-2-((S)-1-phenylethyl)-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1S,3S,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate (CAS 1628628-46-5) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. IUPAC name: ethyl (1S,3S,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate. InChIKey: WPVULUCPUMGINO-HNKHHVNMSA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | ethyl (1S,3S,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| InChIKey | WPVULUCPUMGINO-HNKHHVNMSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@H](N1[C@@H](C)C3=CC=CC=C3)C=C2 |
Computed by PubChem (NCBI)