CAS 1628641-89-3 is the registry number for GPR120 Agonist 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[[1-(4-chlorophenyl)-3-(trifluoromethyl)pyrrol-2-yl]methoxy]-3,5-difluorophenyl]propanoic acid (CAS 1628641-89-3) is a chemical compound with the molecular formula C21H15ClF5NO3 and a molecular weight of 459.8 g/mol. IUPAC name: 3-[4-[[1-(4-chlorophenyl)-3-(trifluoromethyl)pyrrol-2-yl]methoxy]-3,5-difluorophenyl]propanoic acid. InChIKey: QBQBMUDNSMUHRR-UHFFFAOYSA-N.
| Molecular formula | C21H15ClF5NO3 |
|---|---|
| Molecular weight | 459.8 g/mol |
| IUPAC name | 3-[4-[[1-(4-chlorophenyl)-3-(trifluoromethyl)pyrrol-2-yl]methoxy]-3,5-difluorophenyl]propanoic acid |
| InChIKey | QBQBMUDNSMUHRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=CC(=C2COC3=C(C=C(C=C3F)CCC(=O)O)F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)