Products 1628748-83-3
CAS 1628748-83-3 appears in our catalog under these names: tert-Butyl 2,2-dimethyl-3-oxoazetidine-1-carboxylate, tert-Butyl 2,2-dimethyl-3-oxoazetidine-1-carboxylate, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 250mg, 100mg, 1g, 5g.
Tert-butyl 2,2-dimethyl-3-oxoazetidine-1-carboxylate (CAS 1628748-83-3) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-3-oxoazetidine-1-carboxylate. InChIKey: XBMJUOJTMXHRBL-UHFFFAOYSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | tert-butyl 2,2-dimethyl-3-oxoazetidine-1-carboxylate |
| InChIKey | XBMJUOJTMXHRBL-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)