CAS 1628753-60-5 appears in our catalog under these names: Cyclopentylamine-3,3,4,4-d4, Cyclopentylamine-d4. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3,3,4,4-tetradeuteriocyclopentan-1-amine (CAS 1628753-60-5) is a chemical compound with the molecular formula C5H11N and a molecular weight of 89.17 g/mol. IUPAC name: 3,3,4,4-tetradeuteriocyclopentan-1-amine. InChIKey: NISGSNTVMOOSJQ-LNLMKGTHSA-N.
| Molecular formula | C5H11N |
|---|---|
| Molecular weight | 89.17 g/mol |
| IUPAC name | 3,3,4,4-tetradeuteriocyclopentan-1-amine |
| InChIKey | NISGSNTVMOOSJQ-LNLMKGTHSA-N |
| SMILES | [2H]C1(CC(CC1([2H])[2H])N)[2H] |
Computed by PubChem (NCBI)