Products 1628784-53-1

CAS 1628784-53-1 is the registry number for BG48, 99.09%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-(2-aminophenyl)-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide (CAS 1628784-53-1) is a chemical compound with the molecular formula C21H21N5O and a molecular weight of 359.4 g/mol. IUPAC name: N-(2-aminophenyl)-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide. InChIKey: JTNDTZSCCLTZNP-UHFFFAOYSA-N.

Identity
Molecular formulaC21H21N5O
Molecular weight359.4 g/mol
IUPAC nameN-(2-aminophenyl)-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide
InChIKeyJTNDTZSCCLTZNP-UHFFFAOYSA-N
SMILESCN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)NC3=CC=CC=C3N

Computed by PubChem (NCBI)

Synonyms: orb1701062