Products 1628784-54-2
CAS 1628784-54-2 is the registry number for BG47. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-hydroxy-5-thiophen-2-ylphenyl)benzamide (CAS 1628784-54-2) is a chemical compound with the molecular formula C25H22N4O2S and a molecular weight of 442.5 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-hydroxy-5-thiophen-2-ylphenyl)benzamide. InChIKey: PNYUFPRPRATUNE-UHFFFAOYSA-N.
| Molecular formula | C25H22N4O2S |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-hydroxy-5-thiophen-2-ylphenyl)benzamide |
| InChIKey | PNYUFPRPRATUNE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)NC3=C(C=CC(=C3)C4=CC=CS4)O |
Computed by PubChem (NCBI)
Synonyms:
cis-BG47, orb1701061