CAS 1628797-61-4 is the registry number for 3-Methylimidazolidine-2,4-dione-D3. Offered by: TRC. Available pack sizes: 500mg.
3-(trideuteriomethyl)imidazolidine-2,4-dione (CAS 1628797-61-4) is a chemical compound with the molecular formula C4H6N2O2 and a molecular weight of 117.12 g/mol. IUPAC name: 3-(trideuteriomethyl)imidazolidine-2,4-dione. InChIKey: MZQQHYDUINOMDG-FIBGUPNXSA-N.
| Molecular formula | C4H6N2O2 |
|---|---|
| Molecular weight | 117.12 g/mol |
| IUPAC name | 3-(trideuteriomethyl)imidazolidine-2,4-dione |
| InChIKey | MZQQHYDUINOMDG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CNC1=O |
Computed by PubChem (NCBI)