Products 162880-44-6

CAS 162880-44-6 is the registry number for 2,4-Diaminothiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,4-diamino-1,3-thiazole-5-carboxylic acid (CAS 162880-44-6) is a chemical compound with the molecular formula C4H5N3O2S and a molecular weight of 159.17 g/mol. IUPAC name: 2,4-diamino-1,3-thiazole-5-carboxylic acid. InChIKey: YJZORBHGLHJOHS-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5N3O2S
Molecular weight159.17 g/mol
IUPAC name2,4-diamino-1,3-thiazole-5-carboxylic acid
InChIKeyYJZORBHGLHJOHS-UHFFFAOYSA-N
SMILESC1(=C(N=C(S1)N)N)C(=O)O

Computed by PubChem (NCBI)