CAS 1628918-33-1 appears in our catalog under these names: 4-Bromo-1-chloro-2-((4-fluorophenyl)methyl)benzene, Empagliflozin impurity 25. Offered by: TRC, Biosynth. Available pack sizes: 1g, 50mg, 25mg, 100mg, 500mg, 250mg.
4-bromo-1-chloro-2-[(4-fluorophenyl)methyl]benzene (CAS 1628918-33-1) is a chemical compound with the molecular formula C13H9BrClF and a molecular weight of 299.56 g/mol. IUPAC name: 4-bromo-1-chloro-2-[(4-fluorophenyl)methyl]benzene. InChIKey: PRJCCPJWDDDOER-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClF |
|---|---|
| Molecular weight | 299.56 g/mol |
| IUPAC name | 4-bromo-1-chloro-2-[(4-fluorophenyl)methyl]benzene |
| InChIKey | PRJCCPJWDDDOER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=C(C=CC(=C2)Br)Cl)F |
Computed by PubChem (NCBI)