CAS 1629134-61-7 is the registry number for 2-(3-Fluoro-5-(methylsulfonyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-fluoro-5-methylsulfonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1629134-61-7) is a chemical compound with the molecular formula C13H18BFO4S and a molecular weight of 300.2 g/mol. IUPAC name: 2-(3-fluoro-5-methylsulfonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QSBSLFMNFBKECX-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO4S |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | 2-(3-fluoro-5-methylsulfonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QSBSLFMNFBKECX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)S(=O)(=O)C)F |
Computed by PubChem (NCBI)