CAS 1629138-41-5 appears in our catalog under these names: SRI–011381, SRI-011381, SRI-011381/ 99.11% (existing batch purity), SRI-011381 98%, SRI-011381, 98%, 98%. Offered by: GLPBio, Chemat Brand, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, on request, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg.
1-benzyl-3-cyclohexyl-1-(piperidin-4-ylmethyl)urea (CAS 1629138-41-5) is a chemical compound with the molecular formula C20H31N3O and a molecular weight of 329.5 g/mol. IUPAC name: 1-benzyl-3-cyclohexyl-1-(piperidin-4-ylmethyl)urea. InChIKey: LNOPAJNGRAPFKZ-UHFFFAOYSA-N.
| Molecular formula | C20H31N3O |
|---|---|
| Molecular weight | 329.5 g/mol |
| IUPAC name | 1-benzyl-3-cyclohexyl-1-(piperidin-4-ylmethyl)urea |
| InChIKey | LNOPAJNGRAPFKZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)N(CC2CCNCC2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)