CAS 1629166-79-5 is the registry number for (2,5-Dibromophenyl)diphenylphosphine oxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dibromo-2-diphenylphosphorylbenzene (CAS 1629166-79-5) is a chemical compound with the molecular formula C18H13Br2OP and a molecular weight of 436.1 g/mol. IUPAC name: 1,4-dibromo-2-diphenylphosphorylbenzene. InChIKey: HCWMKUFIKIQADR-UHFFFAOYSA-N.
| Molecular formula | C18H13Br2OP |
|---|---|
| Molecular weight | 436.1 g/mol |
| IUPAC name | 1,4-dibromo-2-diphenylphosphorylbenzene |
| InChIKey | HCWMKUFIKIQADR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C=CC(=C3)Br)Br |
Computed by PubChem (NCBI)