CAS 16292-90-3 appears in our catalog under these names: 3–Amino–4–nitrophenol, 3-Amino-4-nitrophenol 95%, 3-Amino-4-nitrophenol, 98%, Phenol, 3-amino-4-nitro-, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
3-amino-4-nitrophenol (CAS 16292-90-3) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 3-amino-4-nitrophenol. InChIKey: WGEZJWMZNGUEHR-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 3-amino-4-nitrophenol |
| InChIKey | WGEZJWMZNGUEHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)