Products 1629269-31-3

CAS 1629269-31-3 is the registry number for 4-Chloro-5-iodo-2-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-chloro-5-iodo-2-methoxybenzoate (CAS 1629269-31-3) is a chemical compound with the molecular formula C9H8ClIO3 and a molecular weight of 326.51 g/mol. IUPAC name: methyl 4-chloro-5-iodo-2-methoxybenzoate. InChIKey: BELJKPCYQONTIG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClIO3
Molecular weight326.51 g/mol
IUPAC namemethyl 4-chloro-5-iodo-2-methoxybenzoate
InChIKeyBELJKPCYQONTIG-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)OC)I)Cl

Computed by PubChem (NCBI)