CAS 1629269-31-3 is the registry number for 4-Chloro-5-iodo-2-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 4-chloro-5-iodo-2-methoxybenzoate (CAS 1629269-31-3) is a chemical compound with the molecular formula C9H8ClIO3 and a molecular weight of 326.51 g/mol. IUPAC name: methyl 4-chloro-5-iodo-2-methoxybenzoate. InChIKey: BELJKPCYQONTIG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClIO3 |
|---|---|
| Molecular weight | 326.51 g/mol |
| IUPAC name | methyl 4-chloro-5-iodo-2-methoxybenzoate |
| InChIKey | BELJKPCYQONTIG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)I)Cl |
Computed by PubChem (NCBI)