Products 1629740-50-6
CAS 1629740-50-6 is the registry number for 1-Pyrrolidinecarboxylic acid, 3-fluoro-4-(hydroxymethyl)-, 1,1-dimethylethyl ester, (3R,4S)-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R,4S)-3-fluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 1629740-50-6) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (3R,4S)-3-fluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: UUTMCLLVLHWFJR-YUMQZZPRSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-fluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | UUTMCLLVLHWFJR-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)F)CO |
Computed by PubChem (NCBI)