CAS 16298-38-7 appears in our catalog under these names: 4,4'-Methylenebis(2-isopropyl-6-methylaniline), 95%, 4,4'-Methylenebis(2-Isopropyl-6-Methyllaniline). Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.
4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylaniline (CAS 16298-38-7) is a chemical compound with the molecular formula C21H30N2 and a molecular weight of 310.5 g/mol. IUPAC name: 4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylaniline. InChIKey: FLNVGZMDLLIECD-UHFFFAOYSA-N.
| Molecular formula | C21H30N2 |
|---|---|
| Molecular weight | 310.5 g/mol |
| IUPAC name | 4-[(4-amino-3-methyl-5-propan-2-ylphenyl)methyl]-2-methyl-6-propan-2-ylaniline |
| InChIKey | FLNVGZMDLLIECD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C(C)C)CC2=CC(=C(C(=C2)C)N)C(C)C |
Computed by PubChem (NCBI)