CAS 1629857-89-1 is the registry number for 2-((4-Chlorophenyl)formamido)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-[(4-chlorobenzoyl)amino]-3-methylbutanoic acid (CAS 1629857-89-1) is a chemical compound with the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]-3-methylbutanoic acid. InChIKey: MKKHOWQSYIOOLE-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)amino]-3-methylbutanoic acid |
| InChIKey | MKKHOWQSYIOOLE-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)