Products 1629857-89-1

CAS 1629857-89-1 is the registry number for 2-((4-Chlorophenyl)formamido)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-[(4-chlorobenzoyl)amino]-3-methylbutanoic acid (CAS 1629857-89-1) is a chemical compound with the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]-3-methylbutanoic acid. InChIKey: MKKHOWQSYIOOLE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClNO3
Molecular weight255.70 g/mol
IUPAC name2-[(4-chlorobenzoyl)amino]-3-methylbutanoic acid
InChIKeyMKKHOWQSYIOOLE-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)NC(=O)C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)