Products 1630022-93-3

CAS 1630022-93-3 is the registry number for AB Pinaca 5-Pentanoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

5-[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid (CAS 1630022-93-3) is a chemical compound with the molecular formula C18H24N4O4 and a molecular weight of 360.4 g/mol. IUPAC name: 5-[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid. InChIKey: QNEBIXFSJOHXCK-HNNXBMFYSA-N.

Identity
Molecular formulaC18H24N4O4
Molecular weight360.4 g/mol
IUPAC name5-[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid
InChIKeyQNEBIXFSJOHXCK-HNNXBMFYSA-N
SMILESCC(C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CCCCC(=O)O

Computed by PubChem (NCBI)