CAS 1630022-93-3 is the registry number for AB Pinaca 5-Pentanoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
5-[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid (CAS 1630022-93-3) is a chemical compound with the molecular formula C18H24N4O4 and a molecular weight of 360.4 g/mol. IUPAC name: 5-[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid. InChIKey: QNEBIXFSJOHXCK-HNNXBMFYSA-N.
| Molecular formula | C18H24N4O4 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-[3-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid |
| InChIKey | QNEBIXFSJOHXCK-HNNXBMFYSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CCCCC(=O)O |
Computed by PubChem (NCBI)