CAS 1630205-15-0 is the registry number for tert-Butyl N-(3-{((tert-butoxy)carbonyl)amino}-5-tert-butylphenyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[3-tert-butyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate (CAS 1630205-15-0) is a chemical compound with the molecular formula C20H32N2O4 and a molecular weight of 364.5 g/mol. IUPAC name: tert-butyl N-[3-tert-butyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate. InChIKey: LQLBLPJQDHZKSA-UHFFFAOYSA-N.
| Molecular formula | C20H32N2O4 |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | tert-butyl N-[3-tert-butyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
| InChIKey | LQLBLPJQDHZKSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)