CAS 1630495-56-5 is the registry number for (S)-(4-Amino-8-fluorothiochroman-4-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(4S)-4-amino-8-fluoro-2,3-dihydrothiochromen-4-yl]methanol (CAS 1630495-56-5) is a chemical compound with the molecular formula C10H12FNOS and a molecular weight of 213.27 g/mol. IUPAC name: [(4S)-4-amino-8-fluoro-2,3-dihydrothiochromen-4-yl]methanol. InChIKey: CWOKOQMWZDTXRK-SNVBAGLBSA-N.
| Molecular formula | C10H12FNOS |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | [(4S)-4-amino-8-fluoro-2,3-dihydrothiochromen-4-yl]methanol |
| InChIKey | CWOKOQMWZDTXRK-SNVBAGLBSA-N |
| SMILES | C1CSC2=C([C@@]1(CO)N)C=CC=C2F |
Computed by PubChem (NCBI)