Products 163083-10-1
CAS 163083-10-1 is the registry number for 1-(4-methoxyphenyl)-2,6,6-trimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-methoxyphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (CAS 163083-10-1) is a chemical compound with the molecular formula C18H21NO2 and a molecular weight of 283.4 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one. InChIKey: MOXQEAHYSLVEDS-UHFFFAOYSA-N.
| Molecular formula | C18H21NO2 |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| InChIKey | MOXQEAHYSLVEDS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)OC)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)