CAS 163089-71-2 appears in our catalog under these names: Huperzine C, Huperzine C. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 2.5 mg.
(1R,9R,13R)-1-amino-13-ethenyl-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (CAS 163089-71-2) is a chemical compound with the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. IUPAC name: (1R,9R,13R)-1-amino-13-ethenyl-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one. InChIKey: IZGRHSRWTILCID-FIXISWKDSA-N.
| Molecular formula | C15H18N2O |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | (1R,9R,13R)-1-amino-13-ethenyl-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| InChIKey | IZGRHSRWTILCID-FIXISWKDSA-N |
| SMILES | CC1=C[C@H]2CC3=C(C=CC(=O)N3)[C@@](C1)([C@@H]2C=C)N |
Computed by PubChem (NCBI)