CAS 16310-20-6 appears in our catalog under these names: Serotonin Impurity 7, Serotonin O-Sulfate, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[3-(2-aminoethyl)-1H-indol-5-yl] hydrogen sulfate (CAS 16310-20-6) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: [3-(2-aminoethyl)-1H-indol-5-yl] hydrogen sulfate. InChIKey: JFWYSGGSCOOBGK-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | [3-(2-aminoethyl)-1H-indol-5-yl] hydrogen sulfate |
| InChIKey | JFWYSGGSCOOBGK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OS(=O)(=O)O)C(=CN2)CCN |
Computed by PubChem (NCBI)