CAS 163119-16-2 appears in our catalog under these names: 2,6–Di–tert–butyl–4–methylcyclohexanol, 2,6-Di-tert-butyl-4-methylcyclohexanol, 95%, 95%, 2,6-Di-tert-butyl-4-methylcyclohexanol, 97%,RG, 2,6-Di-tert-butyl-4-methylcyclohexanol, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 10g, 50g.
2,6-ditert-butyl-4-methylcyclohexan-1-ol (CAS 163119-16-2) is a chemical compound with the molecular formula C15H30O and a molecular weight of 226.40 g/mol. IUPAC name: 2,6-ditert-butyl-4-methylcyclohexan-1-ol. InChIKey: OIXQKWDQCODZGF-UHFFFAOYSA-N.
| Molecular formula | C15H30O |
|---|---|
| Molecular weight | 226.40 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-methylcyclohexan-1-ol |
| InChIKey | OIXQKWDQCODZGF-UHFFFAOYSA-N |
| SMILES | CC1CC(C(C(C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)