CAS 1631977-20-2 is the registry number for 1H-1,2,4-Triazole-1-butanoic acid,b-(2-(4-chlorophenyl)ethyl)-b-hydroxy-a,a-dimethyl. Offered by: TRC. Available pack sizes: 50mg.
5-(4-chlorophenyl)-3-hydroxy-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentanoic acid (CAS 1631977-20-2) is a chemical compound with the molecular formula C16H20ClN3O3 and a molecular weight of 337.80 g/mol. IUPAC name: 5-(4-chlorophenyl)-3-hydroxy-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentanoic acid. InChIKey: UBOTZECGDNAWAP-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN3O3 |
|---|---|
| Molecular weight | 337.80 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3-hydroxy-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentanoic acid |
| InChIKey | UBOTZECGDNAWAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)C(CCC1=CC=C(C=C1)Cl)(CN2C=NC=N2)O |
Computed by PubChem (NCBI)