Products 20432-72-8
CAS 20432-72-8 is the registry number for Prazitone Hydrochloride. Offered by: LoGiCal. Available pack sizes: 10mg.
5-phenyl-5-(piperidin-2-ylmethyl)-1,3-diazinane-2,4,6-trione;hydrochloride (CAS 20432-72-8) is a chemical compound with the molecular formula C16H20ClN3O3 and a molecular weight of 337.80 g/mol. IUPAC name: 5-phenyl-5-(piperidin-2-ylmethyl)-1,3-diazinane-2,4,6-trione;hydrochloride. InChIKey: DFRFWEIVVHHTRM-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN3O3 |
|---|---|
| Molecular weight | 337.80 g/mol |
| IUPAC name | 5-phenyl-5-(piperidin-2-ylmethyl)-1,3-diazinane-2,4,6-trione;hydrochloride |
| InChIKey | DFRFWEIVVHHTRM-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)CC2(C(=O)NC(=O)NC2=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)