CAS 163210-89-7 appears in our catalog under these names: Boc-L-HAla(4-Br)-OtBu, Butanoic acid, 4-bromo-2-[[(1,1-dimethylethoxy)carbonyl]amino]-,1,1-dimethylethyl ester, (2S)-, >95%, >95%, TERT-BUTYL (S)-4-BROMO-2-(BOC-AMINO)BUTYRATE, >95%. Offered by: Iris Biotech, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g, 100mg, 10g.
Tert-butyl (2S)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 163210-89-7) is a chemical compound with the molecular formula C13H24BrNO4 and a molecular weight of 338.24 g/mol. IUPAC name: tert-butyl (2S)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: KAHXNHVFTFWYDP-VIFPVBQESA-N.
| Molecular formula | C13H24BrNO4 |
|---|---|
| Molecular weight | 338.24 g/mol |
| IUPAC name | tert-butyl (2S)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | KAHXNHVFTFWYDP-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCBr)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)