Products 163213-29-4

CAS 163213-29-4 is the registry number for Dimethyl 1-(2-bromoethyl)-1h-pyrazole-3,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 1-(2-bromoethyl)pyrazole-3,5-dicarboxylate (CAS 163213-29-4) is a chemical compound with the molecular formula C9H11BrN2O4 and a molecular weight of 291.10 g/mol. IUPAC name: dimethyl 1-(2-bromoethyl)pyrazole-3,5-dicarboxylate. InChIKey: UOIHKXZPZGPUMY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrN2O4
Molecular weight291.10 g/mol
IUPAC namedimethyl 1-(2-bromoethyl)pyrazole-3,5-dicarboxylate
InChIKeyUOIHKXZPZGPUMY-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NN1CCBr)C(=O)OC

Computed by PubChem (NCBI)