CAS 1632130-37-0 is the registry number for (3,5-difluorophenyl)(phenyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-difluoro-5-phenylsulfanylbenzene (CAS 1632130-37-0) is a chemical compound with the molecular formula C12H8F2S and a molecular weight of 222.26 g/mol. IUPAC name: 1,3-difluoro-5-phenylsulfanylbenzene. InChIKey: LJTKCSMFAUWXAX-UHFFFAOYSA-N.
| Molecular formula | C12H8F2S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 1,3-difluoro-5-phenylsulfanylbenzene |
| InChIKey | LJTKCSMFAUWXAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)