CAS 163217-66-1 is the registry number for N-4-Benzyloxyphenyl a-benzilidene isobutyrylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-2-benzylidene-4-methyl-3-oxo-N-(4-phenylmethoxyphenyl)pentanamide (CAS 163217-66-1) is a chemical compound with the molecular formula C26H25NO3 and a molecular weight of 399.5 g/mol. IUPAC name: (2Z)-2-benzylidene-4-methyl-3-oxo-N-(4-phenylmethoxyphenyl)pentanamide. InChIKey: FCQZYAJFAUTKRU-ULJHMMPZSA-N.
| Molecular formula | C26H25NO3 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | (2Z)-2-benzylidene-4-methyl-3-oxo-N-(4-phenylmethoxyphenyl)pentanamide |
| InChIKey | FCQZYAJFAUTKRU-ULJHMMPZSA-N |
| SMILES | CC(C)C(=O)/C(=C/C1=CC=CC=C1)/C(=O)NC2=CC=C(C=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)