CAS 1632286-18-0 is the registry number for (4-(4-Methylpiperazin-1-yl)phenyl)methanamine 2,2,2-trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-(4-methylpiperazin-1-yl)phenyl]methanamine;2,2,2-trifluoroacetic acid (CAS 1632286-18-0) is a chemical compound with the molecular formula C14H20F3N3O2 and a molecular weight of 319.32 g/mol. IUPAC name: [4-(4-methylpiperazin-1-yl)phenyl]methanamine;2,2,2-trifluoroacetic acid. InChIKey: BJNZRTVDMUTNIY-UHFFFAOYSA-N.
| Molecular formula | C14H20F3N3O2 |
|---|---|
| Molecular weight | 319.32 g/mol |
| IUPAC name | [4-(4-methylpiperazin-1-yl)phenyl]methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | BJNZRTVDMUTNIY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)