Products 1632310-37-2
CAS 1632310-37-2 is the registry number for (5-Bromopyridin-2-yl)(imino)(methyl)-l6-sulfanone, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(5-bromo-2-pyridinyl)-imino-methyl-oxo-lambda6-sulfane (CAS 1632310-37-2) is a chemical compound with the molecular formula C6H7BrN2OS and a molecular weight of 235.10 g/mol. IUPAC name: (5-bromo-2-pyridinyl)-imino-methyl-oxo-lambda6-sulfane. InChIKey: ISKVCXVVNLZJSN-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2OS |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | (5-bromo-2-pyridinyl)-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | ISKVCXVVNLZJSN-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)