Products 163239-24-5
CAS 163239-24-5 is the registry number for PD-147693. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(5R)-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexen-1-yl]phenol (CAS 163239-24-5) is a chemical compound with the molecular formula C24H27NO and a molecular weight of 345.5 g/mol. IUPAC name: 4-[(5R)-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexen-1-yl]phenol. InChIKey: GHLIXCKZQCRDAX-LJQANCHMSA-N.
| Molecular formula | C24H27NO |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | 4-[(5R)-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexen-1-yl]phenol |
| InChIKey | GHLIXCKZQCRDAX-LJQANCHMSA-N |
| SMILES | C1C[C@H](CC(=C1)C2=CC=C(C=C2)O)CN3CCC(=CC3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)