CAS 1632402-15-3 appears in our catalog under these names: (Methanetetrayltetrakis(benzene–4,1–diyl))tetrakis(phosphonic acid), (Methanetetrayltetrakis(benzene-4,1-diyl))tetrakis(phosphonic acid), 98%, 98%, (Methanetetrayltetrakis(benzene-4,1-diyl))tetrakis(phosphonic acid), 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 50mg, 250mg, 100mg.
[4-[tris(4-phosphonophenyl)methyl]phenyl]phosphonic acid (CAS 1632402-15-3) is a chemical compound with the molecular formula C25H24O12P4 and a molecular weight of 640.3 g/mol. IUPAC name: [4-[tris(4-phosphonophenyl)methyl]phenyl]phosphonic acid. InChIKey: IWUHRMLGKIQARK-UHFFFAOYSA-N.
| Molecular formula | C25H24O12P4 |
|---|---|
| Molecular weight | 640.3 g/mol |
| IUPAC name | [4-[tris(4-phosphonophenyl)methyl]phenyl]phosphonic acid |
| InChIKey | IWUHRMLGKIQARK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)P(=O)(O)O)(C3=CC=C(C=C3)P(=O)(O)O)C4=CC=C(C=C4)P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)