CAS 163251-01-2 appears in our catalog under these names: (R)-2-(2-Phenylacetamido)hexanedioic acid, 97%, (R)-2-(2-Phenylacetamido)hexanedioic acid, 97%, 97%, (R)–2–Phenylacetylamino–hexanedioic acid. Offered by: AmBeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2R)-2-[(2-phenylacetyl)amino]hexanedioic acid (CAS 163251-01-2) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (2R)-2-[(2-phenylacetyl)amino]hexanedioic acid. InChIKey: NUGWOCPEVIBLNU-LLVKDONJSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2R)-2-[(2-phenylacetyl)amino]hexanedioic acid |
| InChIKey | NUGWOCPEVIBLNU-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)N[C@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)