Products 16326-97-9
CAS 16326-97-9 appears in our catalog under these names: Cis-cyclopentane-1,3-diol, 95%, (1S,3R)-Cyclopentane-1,3-diol, cis-Cyclopentane-1,3-diol 98%, cis-Cyclopentane-1,3-diol, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
Cis-(1R,3S)-cyclopentane-1,3-diol (CAS 16326-97-9) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 102.13 g/mol. IUPAC name: cis-(1R,3S)-cyclopentane-1,3-diol. InChIKey: NUUPJBRGQCEZSI-SYDPRGILSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 102.13 g/mol |
| IUPAC name | cis-(1R,3S)-cyclopentane-1,3-diol |
| InChIKey | NUUPJBRGQCEZSI-SYDPRGILSA-N |
| SMILES | C1C[C@@H](C[C@@H]1O)O |
Computed by PubChem (NCBI)
Synonyms:
cis-cyclopentane-1,3-diol, (1R,3S)-cyclopentane-1,3-diol, 1,3-Cyclopentanediol, cis-, 1,3-Cyclopentanediol, (1R,3S)-rel-, (1S,3R)-Cyclopentane-1,3-diol, (Z)-1,3-Cyclopentanediol, 1,3-cyclopenta, 1,3-cyclopentanediol, (1R,3S)-, rel-(1R,3S)-cyclopentane-1,3-diol, InChI=1/C5H10O2/c6-4-1-2-5(7)3-4/h4-7H,1-3H2/t4-,5