CAS 163276-22-0 is the registry number for ((1E,3E)-4-Phenyl-1,3-butadienyl)-boronic Acid. Offered by: TRC. Available pack sizes: 500mg.
[(1E,3E)-4-phenylbuta-1,3-dienyl]boronic acid (CAS 163276-22-0) is a chemical compound with the molecular formula C10H11BO2 and a molecular weight of 174.01 g/mol. IUPAC name: [(1E,3E)-4-phenylbuta-1,3-dienyl]boronic acid. InChIKey: LVCLBYUQCLJUQM-KBXRYBNXSA-N.
| Molecular formula | C10H11BO2 |
|---|---|
| Molecular weight | 174.01 g/mol |
| IUPAC name | [(1E,3E)-4-phenylbuta-1,3-dienyl]boronic acid |
| InChIKey | LVCLBYUQCLJUQM-KBXRYBNXSA-N |
| SMILES | B(/C=C/C=C/C1=CC=CC=C1)(O)O |
Computed by PubChem (NCBI)