CAS 163380-20-9 appears in our catalog under these names: Ezetimibe Diacetate, Ezetimibe Impurity 29. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 5mg.
[4-[(2S,3R)-3-[(3R)-3-acetyloxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenyl] acetate (CAS 163380-20-9) is a chemical compound with the molecular formula C28H25F2NO5 and a molecular weight of 493.5 g/mol. IUPAC name: [4-[(2S,3R)-3-[(3R)-3-acetyloxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenyl] acetate. InChIKey: DCEGDCNFJOXKQY-ZONZVBGPSA-N.
| Molecular formula | C28H25F2NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | [4-[(2S,3R)-3-[(3R)-3-acetyloxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenyl] acetate |
| InChIKey | DCEGDCNFJOXKQY-ZONZVBGPSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)[C@@H]2[C@H](C(=O)N2C3=CC=C(C=C3)F)CC[C@H](C4=CC=C(C=C4)F)OC(=O)C |
Computed by PubChem (NCBI)