CAS 1634-89-5 appears in our catalog under these names: Z–Glu–Gly–OH, Z-Glu-gly-oh, 98%, Z-Glu-Gly-OH, Cbz-Glu-Gly-OH 98%, Z-Glu-Gly-OH, 98%, 98%. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 5000mg, 10000mg, 100mg, 5 mg, 25 mg.
(4S)-5-(carboxymethylamino)-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 1634-89-5) is a chemical compound with the molecular formula C15H18N2O7 and a molecular weight of 338.31 g/mol. IUPAC name: (4S)-5-(carboxymethylamino)-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: FDTUHSFTKCRNSD-NSHDSACASA-N.
| Molecular formula | C15H18N2O7 |
|---|---|
| Molecular weight | 338.31 g/mol |
| IUPAC name | (4S)-5-(carboxymethylamino)-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | FDTUHSFTKCRNSD-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)