CAS 16343-18-3 appears in our catalog under these names: 1,1,2,2-Tetraphenyldisilane, 95%, 1,1,2,2-Tetraphenyldisilane, 97%, 1,1,2,2–Tetraphenyldisilane, 1,1,2,2-Tetraphenyldisilane, >97.0%(GC), 1,1,2,2-Tetraphenyldisilane, 97.0%, 97.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 250mg, 1g, 2.5g.
Diphenylsilyl(diphenyl)silane (CAS 16343-18-3) is a chemical compound with the molecular formula C24H22Si2 and a molecular weight of 366.6 g/mol. IUPAC name: diphenylsilyl(diphenyl)silane. InChIKey: LKWATTABEBNHPP-UHFFFAOYSA-N.
| Molecular formula | C24H22Si2 |
|---|---|
| Molecular weight | 366.6 g/mol |
| IUPAC name | diphenylsilyl(diphenyl)silane |
| InChIKey | LKWATTABEBNHPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[SiH](C2=CC=CC=C2)[SiH](C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)