CAS 163452-00-4 appears in our catalog under these names: 3-Hydroxybutyric Acid Magnesium Salt, 3–Hydroxybutyric Acid Magnesium Salt, Magnesium (R)-3-hydroxybutanoate, 98%, 98%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 5g, 25g, 100g, 500g.
Magnesium bis(3-hydroxybutanoate) (CAS 163452-00-4) is a chemical compound with the molecular formula C8H14MgO6 and a molecular weight of 230.50 g/mol. IUPAC name: magnesium bis(3-hydroxybutanoate). InChIKey: ZIMQIJFHENOQDO-UHFFFAOYSA-L.
| Molecular formula | C8H14MgO6 |
|---|---|
| Molecular weight | 230.50 g/mol |
| IUPAC name | magnesium bis(3-hydroxybutanoate) |
| InChIKey | ZIMQIJFHENOQDO-UHFFFAOYSA-L |
| SMILES | CC(CC(=O)[O-])O.CC(CC(=O)[O-])O.[Mg+2] |
Computed by PubChem (NCBI)