CAS 163490-80-0 is the registry number for 1-(4-(trifluoromethoxy)phenyl)-3-benzoylthiourea. Offered by: Biosynth. Available pack sizes: 250mg.
N-[[4-(trifluoromethoxy)phenyl]carbamothioyl]benzamide (CAS 163490-80-0) is a chemical compound with the molecular formula C15H11F3N2O2S and a molecular weight of 340.3 g/mol. IUPAC name: N-[[4-(trifluoromethoxy)phenyl]carbamothioyl]benzamide. InChIKey: OSKGYRYYAGHJHS-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O2S |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | N-[[4-(trifluoromethoxy)phenyl]carbamothioyl]benzamide |
| InChIKey | OSKGYRYYAGHJHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)