CAS 163521-19-5 appears in our catalog under these names: Vilazodone Carboxylic Acid, Vilazodone Carboxy Acid, Vilazodone Carboxylic Acid, >95% (HPLC), Vilazodone carboxylic acid, 5-(4-(4-(5-Cyano-1H-indol-3-yl)butyl)piperazin-1-yl)benzofuran-2-carboxylic acid, 98.20%, 98.20%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 1mg, 5mg, 10 mg, 5 mg.
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylic acid (CAS 163521-19-5) is a chemical compound with the molecular formula C26H26N4O3 and a molecular weight of 442.5 g/mol. IUPAC name: 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylic acid. InChIKey: RSXUEYFLDNUILS-UHFFFAOYSA-N.
| Molecular formula | C26H26N4O3 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylic acid |
| InChIKey | RSXUEYFLDNUILS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC5=C(C=C4)OC(=C5)C(=O)O |
Computed by PubChem (NCBI)