CAS 1635437-39-6 appears in our catalog under these names: UMB–32, UMB-32, UMB-32, 99.11%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 50 mg, 10mM/1mL, 25 mg.
N-tert-butyl-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]imidazo[1,2-a]pyrazin-3-amine (CAS 1635437-39-6) is a chemical compound with the molecular formula C21H23N5O and a molecular weight of 361.4 g/mol. IUPAC name: N-tert-butyl-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]imidazo[1,2-a]pyrazin-3-amine. InChIKey: YXPVTKHEWGXKEY-UHFFFAOYSA-N.
| Molecular formula | C21H23N5O |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | N-tert-butyl-2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]imidazo[1,2-a]pyrazin-3-amine |
| InChIKey | YXPVTKHEWGXKEY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=C(C=C2)C3=C(N4C=CN=CC4=N3)NC(C)(C)C |
Computed by PubChem (NCBI)