Products 163564-58-7
CAS 163564-58-7 appears in our catalog under these names: Kadsulignan N, Kadsulignan N, Kadsulignan N, ≥95%, ≥95%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 1 mg, 5 mg.
(1S,14R,15R,16S)-4,5,6,9,10,11-hexamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaene (CAS 163564-58-7) is a chemical compound with the molecular formula C24H30O7 and a molecular weight of 430.5 g/mol. IUPAC name: (1S,14R,15R,16S)-4,5,6,9,10,11-hexamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaene. InChIKey: RRQAIPQPPCAEHD-JARDSOJUSA-N.
| Molecular formula | C24H30O7 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (1S,14R,15R,16S)-4,5,6,9,10,11-hexamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaene |
| InChIKey | RRQAIPQPPCAEHD-JARDSOJUSA-N |
| SMILES | C[C@@H]1[C@@H]([C@H]2C3=CC(=C(C(=C3C4=C(C(=C(C=C4[C@@H]1O2)OC)OC)OC)OC)OC)OC)C |
Computed by PubChem (NCBI)
Synonyms:
kadsulignan N