CAS 16362-53-1 is the registry number for Ethyl 4-(4-chloro-3-nitrobenzenesulfonamido)benzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Ethyl 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate (CAS 16362-53-1) is a chemical compound with the molecular formula C15H13ClN2O6S and a molecular weight of 384.8 g/mol. IUPAC name: ethyl 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate. InChIKey: LIEYHHZKLIIEAX-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O6S |
|---|---|
| Molecular weight | 384.8 g/mol |
| IUPAC name | ethyl 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate |
| InChIKey | LIEYHHZKLIIEAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)