Products 16362-53-1

CAS 16362-53-1 is the registry number for Ethyl 4-(4-chloro-3-nitrobenzenesulfonamido)benzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate (CAS 16362-53-1) is a chemical compound with the molecular formula C15H13ClN2O6S and a molecular weight of 384.8 g/mol. IUPAC name: ethyl 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate. InChIKey: LIEYHHZKLIIEAX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13ClN2O6S
Molecular weight384.8 g/mol
IUPAC nameethyl 4-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoate
InChIKeyLIEYHHZKLIIEAX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)